CAS 692281-56-4 appears in our catalog under these names: 3,5-Dichloro-4-isopropoxybenzaldehyde, 3,5-Dichloro-4-isopropoxybenzaldehyde, 95%, 3,5-Dichloro-4-isopropoxybenzaldehyde, 95+%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 1g, 5g, 25g.
3,5-dichloro-4-propan-2-yloxybenzaldehyde (CAS 692281-56-4) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 3,5-dichloro-4-propan-2-yloxybenzaldehyde. InChIKey: ZSUPYLWHFXVVDP-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 3,5-dichloro-4-propan-2-yloxybenzaldehyde |
| InChIKey | ZSUPYLWHFXVVDP-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Cl)C=O)Cl |
Computed by PubChem (NCBI)