Products 693257-19-1
CAS 693257-19-1 appears in our catalog under these names: 2-(Benzyloxy)-4-bromobenzoic acid, 98%, 2–(Benzyloxy)–4–bromobenzoic acid, 2-(Benzyloxy)-4-bromobenzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.
4-bromo-2-phenylmethoxybenzoic acid (CAS 693257-19-1) is a chemical compound with the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. IUPAC name: 4-bromo-2-phenylmethoxybenzoic acid. InChIKey: BFEVNLBJIJNYRW-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO3 |
|---|---|
| Molecular weight | 307.14 g/mol |
| IUPAC name | 4-bromo-2-phenylmethoxybenzoic acid |
| InChIKey | BFEVNLBJIJNYRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)