Products 693805-48-0
CAS 693805-48-0 is the registry number for 2,5-Dimethoxy-N-methylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2,5-dimethoxy-N-methylbenzenesulfonamide (CAS 693805-48-0) is a chemical compound with the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. IUPAC name: 2,5-dimethoxy-N-methylbenzenesulfonamide. InChIKey: DBFYCPPMAVPSBV-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | 2,5-dimethoxy-N-methylbenzenesulfonamide |
| InChIKey | DBFYCPPMAVPSBV-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=C(C=CC(=C1)OC)OC |
Computed by PubChem (NCBI)