CAS 6941-75-9 appears in our catalog under these names: 4-Bromophthalimide, 97+% , 4-Bromophthalimide, >98.0%(HPLC)(T), 5-Bromoisoindoline-1,3-dione 98%, 5-Bromoisoindoline-1,3-dione, 98%, 98%, 4-Bromophthalimide, 98%. Offered by: Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 100g, 500g, 1g.
5-bromoisoindole-1,3-dione (CAS 6941-75-9) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 5-bromoisoindole-1,3-dione. InChIKey: GNYICZVGHULCHE-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 5-bromoisoindole-1,3-dione |
| InChIKey | GNYICZVGHULCHE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)NC2=O |
Computed by PubChem (NCBI)