CAS 6943-00-6 is the registry number for N-(4-Chlorophenyl)-succinimide, 95%. Offered by: AmBeed. Available pack sizes: 10g.
1-(4-chlorophenyl)pyrrolidine-2,5-dione (CAS 6943-00-6) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: 1-(4-chlorophenyl)pyrrolidine-2,5-dione. InChIKey: MQCXNSWYTPALRY-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 1-(4-chlorophenyl)pyrrolidine-2,5-dione |
| InChIKey | MQCXNSWYTPALRY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)