Products 694479-56-6
CAS 694479-56-6 is the registry number for 6-Methyl-2-oxo-1-(3-(trifluoromethyl)phenyl)-1,2-dihydropyridine-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid (CAS 694479-56-6) is a chemical compound with the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. IUPAC name: 6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid. InChIKey: HGSDSOKEXHWXMU-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO3 |
|---|---|
| Molecular weight | 297.23 g/mol |
| IUPAC name | 6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
| InChIKey | HGSDSOKEXHWXMU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C(=O)N1C2=CC=CC(=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)