CAS 6946-14-1 appears in our catalog under these names: 3-Acetamido-4-methylbenzoic acid, 98%, 3-Acetamido-4-methylbenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 2,5g, 0,25g.
3-acetamido-4-methylbenzoic acid (CAS 6946-14-1) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 3-acetamido-4-methylbenzoic acid. InChIKey: FGHGVZVGAYQACH-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 3-acetamido-4-methylbenzoic acid |
| InChIKey | FGHGVZVGAYQACH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)