Products 6950-43-2
CAS 6950-43-2 appears in our catalog under these names: 5-Bromo-2-nitrobenzoic acid, 5-Bromo-2-nitrobenzoic acid 98%, 5-Bromo-2-nitrobenzoic acid, 99.82%, 5-Bromo-2-nitrobenzoic acid, 98%, 98%, 5-Bromo-2-nitro-benzoic acid, 95%. Offered by: Biosynth, Ambeed, MedChemExpress, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 50g, 1g, 5g, 100g, 1 g, 250mg.
5-bromo-2-nitrobenzoic acid (CAS 6950-43-2) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 5-bromo-2-nitrobenzoic acid. InChIKey: FNINYRSNPGPWEL-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 5-bromo-2-nitrobenzoic acid |
| InChIKey | FNINYRSNPGPWEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)