Products 6952-67-6
CAS 6952-67-6 appears in our catalog under these names: 2-(3-Nitrophenyl)-1,3-dioxolane 95%, 2-(3-Nitrophenyl)-1,3-dioxolane, 95%, 95%, 2-(3-NITROPHENYL)-1,3-DIOXOLANE, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
2-(3-nitrophenyl)-1,3-dioxolane (CAS 6952-67-6) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(3-nitrophenyl)-1,3-dioxolane. InChIKey: YOGPCAYIEHLIMG-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(3-nitrophenyl)-1,3-dioxolane |
| InChIKey | YOGPCAYIEHLIMG-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-(3-nitrophenyl)-1,3-dioxolane, 3-Nitrobenzaldehyde ethylene acetal, 2-(3-Nitro-phenyl)-[1,3]dioxolane, 2-[3-Nitro-phenyl]-[1,3]dioxolane, 2-(m-Nitrophenyl)-1,3-dioxolane, 1,3-Dioxolane, 2-(3-nitrophenyl)-, 2beta-(3-Nitrophenyl)-1,3-dioxolane, 1, 2-(m-nitrophenyl)-, 1, 2-(3-nitrophenyl)-, 3-nitrophenyl-1,3-dioxolane