CAS 6961-25-7 appears in our catalog under these names: 2–Phenylquinolin–8–ol, 2-Phenylquinolin-8-ol 95%, 2-Phenylquinolin-8-ol, 95%, 95%, 2-Phenylquinolin-8-ol, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-phenylquinolin-8-ol (CAS 6961-25-7) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 2-phenylquinolin-8-ol. InChIKey: WOEZGUUDQZLTCQ-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2-phenylquinolin-8-ol |
| InChIKey | WOEZGUUDQZLTCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=CC=C3O)C=C2 |
Computed by PubChem (NCBI)