CAS 6963-03-7 appears in our catalog under these names: 6-Nitro-4H-1,3-benzodioxine, 98%, 6-Nitro-1,3-benzodioxane. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g.
6-nitro-4H-1,3-benzodioxine (CAS 6963-03-7) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 6-nitro-4H-1,3-benzodioxine. InChIKey: RCVQOAMNZPWAIM-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 6-nitro-4H-1,3-benzodioxine |
| InChIKey | RCVQOAMNZPWAIM-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)[N+](=O)[O-])OCO1 |
Computed by PubChem (NCBI)