Products 69630-20-2
CAS 69630-20-2 appears in our catalog under these names: Phenyl morpholine-4-carboxylate, 95%, Phenyl morpholine-4-carboxylate, Phenyl morpholine-4-carboxylate 98%, Phenyl morpholine-4-carboxylate, 98%, 98%, Phenyl morpholine-4-carboxylate, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 50mg, 500mg, 2.5g.
Phenyl morpholine-4-carboxylate (CAS 69630-20-2) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: phenyl morpholine-4-carboxylate. InChIKey: SVWBBVZRYSQHPF-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | phenyl morpholine-4-carboxylate |
| InChIKey | SVWBBVZRYSQHPF-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)