CAS 698379-26-9 appears in our catalog under these names: ethyl 2,2–difluoro–2–(m–tolyl)acetate, Ethyl Difluoro(3-Methylphenyl)Acetate. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 2,5g, 2.5g.
Ethyl 2,2-difluoro-2-(3-methylphenyl)acetate (CAS 698379-26-9) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(3-methylphenyl)acetate. InChIKey: BSPBLKJZDFLMCO-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | ethyl 2,2-difluoro-2-(3-methylphenyl)acetate |
| InChIKey | BSPBLKJZDFLMCO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC(=C1)C)(F)F |
Computed by PubChem (NCBI)