Products 698379-26-9

CAS 698379-26-9 appears in our catalog under these names: ethyl 2,2–difluoro–2–(m–tolyl)acetate, Ethyl Difluoro(3-Methylphenyl)Acetate. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 2,5g, 2.5g.

Structural formula: {0} (CAS {1})

Ethyl 2,2-difluoro-2-(3-methylphenyl)acetate (CAS 698379-26-9) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(3-methylphenyl)acetate. InChIKey: BSPBLKJZDFLMCO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12F2O2
Molecular weight214.21 g/mol
IUPAC nameethyl 2,2-difluoro-2-(3-methylphenyl)acetate
InChIKeyBSPBLKJZDFLMCO-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=CC=CC(=C1)C)(F)F

Computed by PubChem (NCBI)