CAS 69884-05-5 is the registry number for 2-Deoxy-DIMBOA. Offered by: TRC. Available pack sizes: 2,5g.
4-hydroxy-7-methoxy-1,4-benzoxazin-3-one (CAS 69884-05-5) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 4-hydroxy-7-methoxy-1,4-benzoxazin-3-one. InChIKey: AFMLVQPDSTZQOF-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 4-hydroxy-7-methoxy-1,4-benzoxazin-3-one |
| InChIKey | AFMLVQPDSTZQOF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N(C(=O)CO2)O |
Computed by PubChem (NCBI)