CAS 698985-51-2 appears in our catalog under these names: 7-Fluoro-5-nitro-2,3-dihydrobenzo[b][1,4]dioxine, 97%, 97%, 7-FLUORO-5-NITRO-2,3-DIHYDRO-1,4-BENZODIOXINE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
7-fluoro-5-nitro-2,3-dihydro-1,4-benzodioxine (CAS 698985-51-2) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 7-fluoro-5-nitro-2,3-dihydro-1,4-benzodioxine. InChIKey: MRYBANLBNURJIH-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 7-fluoro-5-nitro-2,3-dihydro-1,4-benzodioxine |
| InChIKey | MRYBANLBNURJIH-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2O1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)