CAS 70063-06-8 appears in our catalog under these names: Carbazochrome Impurity 1, Carbazochrome Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
(6-hydroxy-1-methylindol-5-yl)iminourea (CAS 70063-06-8) is a chemical compound with the molecular formula C10H10N4O2 and a molecular weight of 218.21 g/mol. IUPAC name: (6-hydroxy-1-methylindol-5-yl)iminourea. InChIKey: ZRVLWHAWMORRMX-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | (6-hydroxy-1-methylindol-5-yl)iminourea |
| InChIKey | ZRVLWHAWMORRMX-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=CC(=C(C=C21)O)N=NC(=O)N |
Computed by PubChem (NCBI)