Products 7008-63-1
CAS 7008-63-1 appears in our catalog under these names: 6-Phenylimidazo(2,1-b)(1,3)thiazole, 6-Phenylimidazo[2,1-b]thiazole, 98%+(LC-MS),RG. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.
6-phenylimidazo[2,1-b][1,3]thiazole (CAS 7008-63-1) is a chemical compound with the molecular formula C11H8N2S and a molecular weight of 200.26 g/mol. IUPAC name: 6-phenylimidazo[2,1-b][1,3]thiazole. InChIKey: DYYKAVHVTLJEOH-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 6-phenylimidazo[2,1-b][1,3]thiazole |
| InChIKey | DYYKAVHVTLJEOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C=CSC3=N2 |
Computed by PubChem (NCBI)
Synonyms:
6-Phenylimidazo[2,1-b]thiazole, 6-Phenylimidazo(2,1-b)thiazole, Imidazo[2,1-b]thiazole, 6-phenyl-, Imidazo(2,1-b)thiazole, 6-phenyl-, DYYKAVHVTLJEOH-UHFFFAOYSA-N, 6-Phenylimidazo[2,1-b][1,3]thiazole, Imidazo[2,1-b]thiazole,6-phenyl-, 6-phenylimidazo[2,1-b]1,3-thiazoline, Imidazo[2, 6-phenyl-, Maybridge1_007185