Products 70147-57-8
CAS 70147-57-8 is the registry number for ((2R,3S,5R)-5-(6-Amino-9H-purin-9-yl)-3-methoxytetrahydrofuran-2-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-methoxyoxolan-2-yl]methanol (CAS 70147-57-8) is a chemical compound with the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. IUPAC name: [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-methoxyoxolan-2-yl]methanol. InChIKey: FFTJWXISNILIOL-XLPZGREQSA-N.
| Molecular formula | C11H15N5O3 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-methoxyoxolan-2-yl]methanol |
| InChIKey | FFTJWXISNILIOL-XLPZGREQSA-N |
| SMILES | CO[C@H]1C[C@@H](O[C@@H]1CO)N2C=NC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)