CAS 70173-54-5 appears in our catalog under these names: 9-Bromo-julolidine 95%, 9-Bromo-1,2,3,5,6,7-hexahydropyrido[3,2,1-ij]quinoline, 95%, 95%, 4-Bromo-julolidine, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (CAS 70173-54-5) is a chemical compound with the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. IUPAC name: 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene. InChIKey: PVTRKHJBWSTNOI-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN |
|---|---|
| Molecular weight | 252.15 g/mol |
| IUPAC name | 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
| InChIKey | PVTRKHJBWSTNOI-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=CC3=C2N(C1)CCC3)Br |
Computed by PubChem (NCBI)