CAS 70239-81-5 is the registry number for 4-Ethynyl-2-nitrophenol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-ethynyl-2-nitrophenol (CAS 70239-81-5) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 4-ethynyl-2-nitrophenol. InChIKey: NGFZLEANFAKXEA-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 4-ethynyl-2-nitrophenol |
| InChIKey | NGFZLEANFAKXEA-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C(C=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)