Products 70261-41-5
CAS 70261-41-5 is the registry number for 2-(2-(Benzyloxy)-6-nitrophenyl)ethan-1-ol, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(2-nitro-6-phenylmethoxyphenyl)ethanol (CAS 70261-41-5) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: 2-(2-nitro-6-phenylmethoxyphenyl)ethanol. InChIKey: BEGYIGHLVAVFDT-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | 2-(2-nitro-6-phenylmethoxyphenyl)ethanol |
| InChIKey | BEGYIGHLVAVFDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2CCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)