CAS 70371-55-0 is the registry number for 5-Amino-1,3-dimethyl-1H,2H,3H,4H-(1,3)diazino(4,5-d)pyrimidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-amino-1,3-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione (CAS 70371-55-0) is a chemical compound with the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. IUPAC name: 5-amino-1,3-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione. InChIKey: QTHLHHGAZAMWKK-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O2 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 5-amino-1,3-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione |
| InChIKey | QTHLHHGAZAMWKK-UHFFFAOYSA-N |
| SMILES | CN1C2=NC=NC(=C2C(=O)N(C1=O)C)N |
Computed by PubChem (NCBI)