Products 704-03-0

CAS 704-03-0 is the registry number for 5-Fluoro-2-methoxybenzoyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

5-fluoro-2-methoxybenzoyl chloride (CAS 704-03-0) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 5-fluoro-2-methoxybenzoyl chloride. InChIKey: HYILYIULOHATGI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClFO2
Molecular weight188.58 g/mol
IUPAC name5-fluoro-2-methoxybenzoyl chloride
InChIKeyHYILYIULOHATGI-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)F)C(=O)Cl

Computed by PubChem (NCBI)