CAS 70401-31-9 appears in our catalog under these names: Carbamazepine Impurity 9, 2-Methyl-5H-dibenzazepine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
3-methyl-11H-benzo[b][1]benzazepine (CAS 70401-31-9) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 3-methyl-11H-benzo[b][1]benzazepine. InChIKey: KBHZSHJGMSCTKN-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 3-methyl-11H-benzo[b][1]benzazepine |
| InChIKey | KBHZSHJGMSCTKN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)