CAS 70461-58-4 appears in our catalog under these names: Rel-ethyl (1R,2R)-2-(4-fluorophenyl)cyclopropane-1-carboxylate, 98%, trans-2-(4-Fluoro-phenyl)-cyclopropanecarboxylic acid ethyl ester, 98%, 98%, trans-2-(4-Fluoro-phenyl)-cyclopropanecarboxylic acid ethyl ester, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 500mg, 1g.
Trans-ethyl (1R,2R)-2-(4-fluorophenyl)cyclopropane-1-carboxylate (CAS 70461-58-4) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-(4-fluorophenyl)cyclopropane-1-carboxylate. InChIKey: KMFYGBAATKYLCU-WDEREUQCSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-(4-fluorophenyl)cyclopropane-1-carboxylate |
| InChIKey | KMFYGBAATKYLCU-WDEREUQCSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)