CAS 70677-78-0 appears in our catalog under these names: Dimethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate, 95+%, Amlodipine Impurity 84, Dimethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg.
Dimethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 70677-78-0) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: dimethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: QDHIAGVDKRWZNF-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | dimethyl 2,6-dimethyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | QDHIAGVDKRWZNF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC)C2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)