Products 707-17-5
CAS 707-17-5 appears in our catalog under these names: 8-Methyl-1,3-diazaspiro[4.5]decane-2,4-dione, 95%, 8-Methyl-1,3-diazaspiro(4.5)decane-2,4-dione, 98+%, 8-Methyl-1,3-diazaspiro(4.5)decane-2,4-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (CAS 707-17-5) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione. InChIKey: YDHFGMUUNFASMP-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| InChIKey | YDHFGMUUNFASMP-UHFFFAOYSA-N |
| SMILES | CC1CCC2(CC1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)