CAS 70803-96-2 is the registry number for Bromfenac Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
1H-indol-7-yl(phenyl)methanone (CAS 70803-96-2) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 1H-indol-7-yl(phenyl)methanone. InChIKey: FIAMTEUKWUNTSP-UHFFFAOYSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 1H-indol-7-yl(phenyl)methanone |
| InChIKey | FIAMTEUKWUNTSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC3=C2NC=C3 |
Computed by PubChem (NCBI)