CAS 708277-48-9 is the registry number for Ajuforrestin B, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 10mg.
(8S,11bS)-7,11-dihydroxy-3,4,8,11b-tetramethyl-1,2,8,9-tetrahydronaphtho[2,1-f][1]benzofuran-6-one (CAS 708277-48-9) is a chemical compound with the molecular formula C20H22O4 and a molecular weight of 326.4 g/mol. IUPAC name: (8S,11bS)-7,11-dihydroxy-3,4,8,11b-tetramethyl-1,2,8,9-tetrahydronaphtho[2,1-f][1]benzofuran-6-one. InChIKey: YOJNWDYXALZJGT-SBKAZYGRSA-N.
| Molecular formula | C20H22O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | (8S,11bS)-7,11-dihydroxy-3,4,8,11b-tetramethyl-1,2,8,9-tetrahydronaphtho[2,1-f][1]benzofuran-6-one |
| InChIKey | YOJNWDYXALZJGT-SBKAZYGRSA-N |
| SMILES | C[C@@H]1COC2=C(C3=C(C(=O)C=C4[C@@]3(CCC(=C4C)C)C)C(=C12)O)O |
Computed by PubChem (NCBI)