CAS 70978-39-1 appears in our catalog under these names: 5'-Fluoro-2'-hydroxy-3'-nitroacetophenone, 98%, 1-(5-Fluoro-2-hydroxy-3-nitrophenyl)ethanone 95%, 1-(5-Fluoro-2-hydroxy-3-nitrophenyl)ethanone, 95%, 95%, 5'-FLUORO-2'-HYDROXY-3'-NITRO- &. Offered by: Combi-blocks, Ambeed, Chemat, Sigma-Aldrich, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg.
1-(5-fluoro-2-hydroxy-3-nitrophenyl)ethanone (CAS 70978-39-1) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 1-(5-fluoro-2-hydroxy-3-nitrophenyl)ethanone. InChIKey: YVTPUCHIOSGVSH-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 1-(5-fluoro-2-hydroxy-3-nitrophenyl)ethanone |
| InChIKey | YVTPUCHIOSGVSH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)F)[N+](=O)[O-])O |
Computed by PubChem (NCBI)