Products 71089-07-1
CAS 71089-07-1 is the registry number for Acetophthalidin. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-acetyl-5,7-dihydroxy-3H-2-benzofuran-1-one (CAS 71089-07-1) is a chemical compound with the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. IUPAC name: 3-acetyl-5,7-dihydroxy-3H-2-benzofuran-1-one. InChIKey: KLBSSFLIZVTENH-UHFFFAOYSA-N.
| Molecular formula | C10H8O5 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 3-acetyl-5,7-dihydroxy-3H-2-benzofuran-1-one |
| InChIKey | KLBSSFLIZVTENH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1C2=C(C(=CC(=C2)O)O)C(=O)O1 |
Computed by PubChem (NCBI)