cas: 7113-10-2 — see every product listed under this CAS number, including other names
2-Phenylthiazole-4-carboxylic acid, 95% (CAS 7113-10-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F091455-1G |
| cas | 7113-10-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 2.5g | 279.09 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 508.17 Pln | |
| Fluorochem | 25g | 1164.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-phenyl-1,3-thiazole-4-carboxylic acid (CAS 7113-10-2) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 2-phenyl-1,3-thiazole-4-carboxylic acid. InChIKey: IBUSLNJQKLZPNR-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | IBUSLNJQKLZPNR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)