Products 712-56-1

CAS 712-56-1 is the registry number for β-(Aminocarbonyl)benzenepropanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-amino-4-oxo-3-phenylbutanoic acid (CAS 712-56-1) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 4-amino-4-oxo-3-phenylbutanoic acid. InChIKey: PPOIRHDTIDWACH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO3
Molecular weight193.20 g/mol
IUPAC name4-amino-4-oxo-3-phenylbutanoic acid
InChIKeyPPOIRHDTIDWACH-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(CC(=O)O)C(=O)N

Computed by PubChem (NCBI)