Products 71489-74-2
CAS 71489-74-2 is the registry number for 3-Hydroxy-4-methoxy-2-nitrobenzoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
3-hydroxy-4-methoxy-2-nitrobenzoic acid (CAS 71489-74-2) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: 3-hydroxy-4-methoxy-2-nitrobenzoic acid. InChIKey: YYWQCALAWQAWKT-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | 3-hydroxy-4-methoxy-2-nitrobenzoic acid |
| InChIKey | YYWQCALAWQAWKT-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)