CAS 71515-89-4 is the registry number for N-(3,4-Dicyanophenyl)-2-hydroxy-2-methylpropanamide. Offered by: TRC. Available pack sizes: 100mg.
N-(3,4-dicyanophenyl)-2-hydroxy-2-methylpropanamide (CAS 71515-89-4) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: N-(3,4-dicyanophenyl)-2-hydroxy-2-methylpropanamide. InChIKey: YOQSKVQHJRKCNL-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | N-(3,4-dicyanophenyl)-2-hydroxy-2-methylpropanamide |
| InChIKey | YOQSKVQHJRKCNL-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NC1=CC(=C(C=C1)C#N)C#N)O |
Computed by PubChem (NCBI)