CAS 7157-15-5 appears in our catalog under these names: 2-Bromomandelic Acid, 2-(2-Bromophenyl)-2-hydroxyacetic acid, 2-Bromomandelic acid 98%, 2-(2-Bromophenyl)-2-hydroxyacetic acid, 98%, 98%, 2-(2-Bromophenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 500mg, 25g, 10g, 50g, 100g, 250mg, 1g.
2-(2-bromophenyl)-2-hydroxyacetic acid (CAS 7157-15-5) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(2-bromophenyl)-2-hydroxyacetic acid. InChIKey: YBNMJUAXERDNRJ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(2-bromophenyl)-2-hydroxyacetic acid |
| InChIKey | YBNMJUAXERDNRJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)O)Br |
Computed by PubChem (NCBI)