Products 716-76-7
CAS 716-76-7 appears in our catalog under these names: 3-Biphenylcarboxylic Acid, Biphenyl-3-carboxylic acid, Biphenyl–3–carboxylic acid, 3-Biphenylcarboxylic acid, 97%, Biphenyl-3-carboxylic Acid, >98.0%(GC)(T). Offered by: TRC, Chemat, GLPBio, Thermo Scientific (Acros), TCI. Available pack sizes: 50g, 5g, 100g, 25g, 1g, 250mg, 10g.
3-phenylbenzoic acid (CAS 716-76-7) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 3-phenylbenzoic acid. InChIKey: XNLWJFYYOIRPIO-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 3-phenylbenzoic acid |
| InChIKey | XNLWJFYYOIRPIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Biphenyl-3-carboxylic acid, 3-phenylbenzoic acid, [1,1'-Biphenyl]-3-carboxylic acid, (1,1'-Biphenyl)-3-carboxylic acid, Diphenyl-3-carboxylic acid, 1,1'-biphenyl-3-carboxylic acid, 3-biphenyl carboxylic acid, 1,1'-Biphenyl, 3-carboxy acid, 4-09-00-02478 (Beilstein Handbook Reference), WLN: QVR CR