CAS 71675-86-0 appears in our catalog under these names: 2-Methoxy-4-amino-5-ethylthiobenzoic acid, 4-Amino-5-(ethylthio)-2-methoxybenzoic acid 97%, 2-Methoxy-4-amino-5-ethylthiobenzoic acid, 97%, 97%, 4-Amino-5-(ethylthio)-2-methoxybenzoic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 5g, 10g, 25g, 500g.
4-amino-5-ethylsulfanyl-2-methoxybenzoic acid (CAS 71675-86-0) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 4-amino-5-ethylsulfanyl-2-methoxybenzoic acid. InChIKey: BVCKAIGDWABZIE-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 4-amino-5-ethylsulfanyl-2-methoxybenzoic acid |
| InChIKey | BVCKAIGDWABZIE-UHFFFAOYSA-N |
| SMILES | CCSC1=C(C=C(C(=C1)C(=O)O)OC)N |
Computed by PubChem (NCBI)