CAS 717818-05-8 is the registry number for Milrinone Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-5-cyano-6-oxo-1H-pyridine-3-carboxamide (CAS 717818-05-8) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 2-amino-5-cyano-6-oxo-1H-pyridine-3-carboxamide. InChIKey: BRHZQXJMEWERPR-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 2-amino-5-cyano-6-oxo-1H-pyridine-3-carboxamide |
| InChIKey | BRHZQXJMEWERPR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1C(=O)N)N)C#N |
Computed by PubChem (NCBI)