CAS 71953-90-7 appears in our catalog under these names: N-Acetyl-5-methyl-dl-tryptophan, 95%, N-Acetyl-5-methyl-dl-tryptophan, >95% (HPLC), 2-Acetamido-3-(5-methyl-1H-indol-3-yl)propanoic acid, 97%, Ac–5–Me–DL–Trp–OH. Offered by: Combi-blocks, TRC, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-acetamido-3-(5-methyl-1H-indol-3-yl)propanoic acid (CAS 71953-90-7) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: 2-acetamido-3-(5-methyl-1H-indol-3-yl)propanoic acid. InChIKey: GTCLKZDZUKYDDV-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 2-acetamido-3-(5-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | GTCLKZDZUKYDDV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC=C2CC(C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)