Products 71953-92-9
CAS 71953-92-9 is the registry number for 2-acetamido-3-(7-methyl-1H-indol-3-yl)propanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-acetamido-3-(7-methyl-1H-indol-3-yl)propanoic acid (CAS 71953-92-9) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: 2-acetamido-3-(7-methyl-1H-indol-3-yl)propanoic acid. InChIKey: ZYFFGFRKSFUZCH-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 2-acetamido-3-(7-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | ZYFFGFRKSFUZCH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CN2)CC(C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)