Products 721401-43-0
CAS 721401-43-0 appears in our catalog under these names: 8-Isoquinolinylboronic acid, 95-<97%, 8-Isoquinolinylboronic acid, ≥97-<99%, Isoquinolin-8-ylboronic acid 97%, Isoquinolin-8-ylboronic acid, 98%, 98%, 8-Isoquinolineboronic acid, 95%. Offered by: Hoffman Fine Chemicals, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 100mg, 250mg.
Isoquinolin-8-ylboronic acid (CAS 721401-43-0) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: isoquinolin-8-ylboronic acid. InChIKey: RKCMKNFWHLIGSF-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | isoquinolin-8-ylboronic acid |
| InChIKey | RKCMKNFWHLIGSF-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=NC=CC2=CC=C1)(O)O |
Computed by PubChem (NCBI)