CAS 723334-03-0 appears in our catalog under these names: Dimethyl 2-fluorobenzene-1,3-dioate, 95%, dimethyl 2-fluorobenzene-1,3-dicarboxylate, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
Dimethyl 2-fluorobenzene-1,3-dicarboxylate (CAS 723334-03-0) is a chemical compound with the molecular formula C10H9FO4 and a molecular weight of 212.17 g/mol. IUPAC name: dimethyl 2-fluorobenzene-1,3-dicarboxylate. InChIKey: OSPJANZFCZYKEH-UHFFFAOYSA-N.
| Molecular formula | C10H9FO4 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | dimethyl 2-fluorobenzene-1,3-dicarboxylate |
| InChIKey | OSPJANZFCZYKEH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)C(=O)OC)F |
Computed by PubChem (NCBI)