CAS 7249-26-5 appears in our catalog under these names: 5–Methylumbelliferone, 5-Methylumbelliferone, >95.0%(GC), 7-Hydroxy-5-methyl-2H-chromen-2-one, 95%, 95%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 100mg.
7-hydroxy-5-methylchromen-2-one (CAS 7249-26-5) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: 7-hydroxy-5-methylchromen-2-one. InChIKey: QNDMQTVAGWUUDS-UHFFFAOYSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 7-hydroxy-5-methylchromen-2-one |
| InChIKey | QNDMQTVAGWUUDS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C=CC(=O)O2)O |
Computed by PubChem (NCBI)