CAS 72511-88-7 appears in our catalog under these names: Phenylephrine Impurity 44 HCl, 1,2,3,4-Tetrahydro-4,6-isoquinolinediol Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
1,2,3,4-tetrahydroisoquinoline-4,6-diol;hydrochloride (CAS 72511-88-7) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 1,2,3,4-tetrahydroisoquinoline-4,6-diol;hydrochloride. InChIKey: FXGOKNDQTQOHDP-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroisoquinoline-4,6-diol;hydrochloride |
| InChIKey | FXGOKNDQTQOHDP-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(CN1)C=CC(=C2)O)O.Cl |
Computed by PubChem (NCBI)