CAS 72518-16-2 appears in our catalog under these names: 3–Bromo–2–fluoro–5–methylbenzoic acid, 3-bromo-2-fluoro-5-methylbenzoic acid, 3-Bromo-2-fluoro-5-methylbenzoic acid 95%, 3-BROMO-2-FLUORO-5-METHYLBENZOIC ACID, 95%, 3-Bromo-2-fluoro-5-methylbenzoic acid, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 100g.
3-bromo-2-fluoro-5-methylbenzoic acid (CAS 72518-16-2) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 3-bromo-2-fluoro-5-methylbenzoic acid. InChIKey: JFAQBRSYTNDGBL-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 3-bromo-2-fluoro-5-methylbenzoic acid |
| InChIKey | JFAQBRSYTNDGBL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)F)C(=O)O |
Computed by PubChem (NCBI)