CAS 7254-33-3 is the registry number for 1,5-Dimethyl-1H-pyrazolo(3,4-d)pyrimidine-4,6(5H,7H)-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,5-dimethyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dione (CAS 7254-33-3) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 180.16 g/mol. IUPAC name: 1,5-dimethyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dione. InChIKey: QEIXSXWGXSQULN-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 1,5-dimethyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dione |
| InChIKey | QEIXSXWGXSQULN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=O)N(C(=O)N2)C |
Computed by PubChem (NCBI)