CAS 725712-36-7 is the registry number for 4-Methoxy-2-nitrostilbene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
4-methoxy-2-nitro-1-(2-phenylethenyl)benzene (CAS 725712-36-7) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 4-methoxy-2-nitro-1-(2-phenylethenyl)benzene. InChIKey: ILSRTSWWIBNXTQ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 4-methoxy-2-nitro-1-(2-phenylethenyl)benzene |
| InChIKey | ILSRTSWWIBNXTQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C=CC2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)