Products 725746-95-2

CAS 725746-95-2 appears in our catalog under these names: 5-Methyl-1-(2-methylpropyl)-1H-pyrazole-4-carboxylic acid, 95%, 5-Methyl-1-(2-methylpropyl)-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-methyl-1-(2-methylpropyl)pyrazole-4-carboxylic acid (CAS 725746-95-2) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 5-methyl-1-(2-methylpropyl)pyrazole-4-carboxylic acid. InChIKey: PXSREVWYXLMXNJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14N2O2
Molecular weight182.22 g/mol
IUPAC name5-methyl-1-(2-methylpropyl)pyrazole-4-carboxylic acid
InChIKeyPXSREVWYXLMXNJ-UHFFFAOYSA-N
SMILESCC1=C(C=NN1CC(C)C)C(=O)O

Computed by PubChem (NCBI)