CAS 72668-56-5 appears in our catalog under these names: 6-Methyl-6,7-dihydropyrazino[2,3-d]pyridazine-5,8-dione, 95%, 6-Methyl-6,7-dihydropyrazino(2,3-d)pyridazine-5,8-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
6-methyl-7H-pyrazino[2,3-d]pyridazine-5,8-dione (CAS 72668-56-5) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 6-methyl-7H-pyrazino[2,3-d]pyridazine-5,8-dione. InChIKey: PYUBLQHYYQQNEF-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 6-methyl-7H-pyrazino[2,3-d]pyridazine-5,8-dione |
| InChIKey | PYUBLQHYYQQNEF-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=NC=CN=C2C(=O)N1 |
Computed by PubChem (NCBI)